C23H30N4O3S — CID 118945861
6-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-methylpyridazin-3-one (PubChem CID 118945861) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 6-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-methylpyridazin-3-one.
| Compound Name | 6-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 118945861 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-methylpyridazin-3-one |
| SMILES | Cn1nc(S(=O)(=O)c2ccc3c(c2)nc(C(C)(C)C)n3CC2CCCCC2)ccc1=O |
| InChI | InChI=1S/C23H30N4O3S/c1-23(2,3)22-24-18-14-17(31(29,30)20-12-13-21(28)26(4)25-20)10-11-19(18)27(22)15-16-8-6-5-7-9-16/h10-14,16H,5-9,15H2,1-4H3 |
| InChIKey | NUCPSZQJHYTYGU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |