C30H42N4O4S — CID 118945878
4-[3-[[4-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-pyridinyl]oxy]propyl]morpholine (PubChem CID 118945878) has the molecular formula C30H42N4O4S and a molecular weight of 554.76 g/mol. Its IUPAC name is 4-[3-[[4-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-pyridinyl]oxy]propyl]morpholine.
| Compound Name | 4-[3-[[4-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-pyridinyl]oxy]propyl]morpholine |
|---|---|
| PubChem CID | 118945878 |
| Molecular Formula | C30H42N4O4S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 4-[3-[[4-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfonyl-2-pyridinyl]oxy]propyl]morpholine |
| SMILES | CC(C)(C)c1nc2cc(S(=O)(=O)c3ccnc(OCCCN4CCOCC4)c3)ccc2n1CC1CCCCC1 |
| InChI | InChI=1S/C30H42N4O4S/c1-30(2,3)29-32-26-20-24(10-11-27(26)34(29)22-23-8-5-4-6-9-23)39(35,36)25-12-13-31-28(21-25)38-17-7-14-33-15-18-37-19-16-33/h10-13,20-21,23H,4-9,14-19,22H2,1-3H3 |
| InChIKey | OBCZPZMZXWJOER-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|