C22H26FN3O3S — CID 118945865
2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(oxan-2-ylmethyl)benzimidazole (PubChem CID 118945865) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(oxan-2-ylmethyl)benzimidazole.
| Compound Name | 2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(oxan-2-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 118945865 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(oxan-2-ylmethyl)benzimidazole |
| SMILES | CC(C)(C)c1nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc2n1CC1CCCCO1 |
| InChI | InChI=1S/C22H26FN3O3S/c1-22(2,3)21-25-18-12-16(30(27,28)17-9-10-24-20(23)13-17)7-8-19(18)26(21)14-15-6-4-5-11-29-15/h7-10,12-13,15H,4-6,11,14H2,1-3H3 |
| InChIKey | QKTHUWISBONUIB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|