About 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole
2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole (PubChem CID 58010467) has the molecular formula C22H28FN3O2S
and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole.
Molecular Properties
| Compound Name | 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole |
| PubChem CID | 58010467 |
| Molecular Formula | C22H28FN3O2S |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole |
| SMILES | CC(C)(C)CCn1c(C(C)(C)C)nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc21 |
| InChI | InChI=1S/C22H28FN3O2S/c1-21(2,3)10-12-26-18-8-7-15(13-17(18)25-20(26)22(4,5)6)29(27,28)16-9-11-24-19(23)14-16/h7-9,11,13-14H,10,12H2,1-6H3 |
| InChIKey | UXXREMAVUHALJN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
The IUPAC name of 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole (CID 58010467) is 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole.
What is the SMILES notation for 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
The canonical SMILES for 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole is CC(C)(C)CCn1c(C(C)(C)C)nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc21.
What is the InChIKey of 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
The InChIKey is UXXREMAVUHALJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28FN3O2S/c1-21(2,3)10-12-26-18-8-7-15(13-17(18)25-20(26)22(4,5)6)29(27,28)16-9-11-24-19(23)14-16/h7-9,11,13-14H,10,12H2,1-6H3.
What are the key properties of 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole?
2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole has a molecular weight of 417.55 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole is sourced from PubChem (CID 58010467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).