C22H28FN3O2S — CID 58010467
2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole (PubChem CID 58010467) has the molecular formula C22H28FN3O2S and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole.
| Compound Name | 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole |
|---|---|
| PubChem CID | 58010467 |
| Molecular Formula | C22H28FN3O2S |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-tert-butyl-1-(3,3-dimethylbutyl)-5-[(2-fluoro-4-pyridinyl)sulfonyl]benzimidazole |
| SMILES | CC(C)(C)CCn1c(C(C)(C)C)nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc21 |
| InChI | InChI=1S/C22H28FN3O2S/c1-21(2,3)10-12-26-18-8-7-15(13-17(18)25-20(26)22(4,5)6)29(27,28)16-9-11-24-19(23)14-16/h7-9,11,13-14H,10,12H2,1-6H3 |
| InChIKey | UXXREMAVUHALJN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|