C24H37N3O3S — CID 23661174
2-tert-butyl-5-(2-ethylpiperidin-1-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole (PubChem CID 23661174) has the molecular formula C24H37N3O3S and a molecular weight of 447.65 g/mol. Its IUPAC name is 2-tert-butyl-5-(2-ethylpiperidin-1-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole.
| Compound Name | 2-tert-butyl-5-(2-ethylpiperidin-1-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 23661174 |
| Molecular Formula | C24H37N3O3S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-tert-butyl-5-(2-ethylpiperidin-1-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCOCC1 |
| InChI | InChI=1S/C24H37N3O3S/c1-5-19-8-6-7-13-27(19)31(28,29)20-9-10-22-21(16-20)25-23(24(2,3)4)26(22)17-18-11-14-30-15-12-18/h9-10,16,18-19H,5-8,11-15,17H2,1-4H3 |
| InChIKey | YYXQAJPCTRXMOI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |