C23H30N3O4S+ — CID 143602895
2-tert-butyl-5-(3-methoxypyridin-1-ium-4-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole (PubChem CID 143602895) has the molecular formula C23H30N3O4S+ and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-tert-butyl-5-(3-methoxypyridin-1-ium-4-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole.
| Compound Name | 2-tert-butyl-5-(3-methoxypyridin-1-ium-4-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 143602895 |
| Molecular Formula | C23H30N3O4S+ |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-tert-butyl-5-(3-methoxypyridin-1-ium-4-yl)sulfonyl-1-(oxan-4-ylmethyl)benzimidazole |
| SMILES | COc1c[nH+]ccc1S(=O)(=O)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCOCC1 |
| InChI | InChI=1S/C23H29N3O4S/c1-23(2,3)22-25-18-13-17(31(27,28)21-7-10-24-14-20(21)29-4)5-6-19(18)26(22)15-16-8-11-30-12-9-16/h5-7,10,13-14,16H,8-9,11-12,15H2,1-4H3/p+1 |
| InChIKey | BGLQYTUZCXKINC-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 84.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |