C28H38N4O2S — CID 143203948
N-[4-[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]butanamide (PubChem CID 143203948) has the molecular formula C28H38N4O2S and a molecular weight of 494.71 g/mol. Its IUPAC name is N-[4-[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]butanamide.
| Compound Name | N-[4-[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 143203948 |
| Molecular Formula | C28H38N4O2S |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-[4-[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(SN(C)c2ccc3c(c2)nc(C(C)(C)C)n3CC2CCOCC2)cc1 |
| InChI | InChI=1S/C28H38N4O2S/c1-6-7-26(33)29-21-8-11-23(12-9-21)35-31(5)22-10-13-25-24(18-22)30-27(28(2,3)4)32(25)19-20-14-16-34-17-15-20/h8-13,18,20H,6-7,14-17,19H2,1-5H3,(H,29,33) |
| InChIKey | LKUMATAEKHDEGA-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|