C27H36N4O3S — CID 143022243
N-[4-[[2-(2-ethoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]acetamide (PubChem CID 143022243) has the molecular formula C27H36N4O3S and a molecular weight of 496.68 g/mol. Its IUPAC name is N-[4-[[2-(2-ethoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[[2-(2-ethoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 143022243 |
| Molecular Formula | C27H36N4O3S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[4-[[2-(2-ethoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]acetamide |
| SMILES | CCOC(C)(C)c1nc2cc(N(C)Sc3ccc(NC(C)=O)cc3)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C27H36N4O3S/c1-6-34-27(3,4)26-29-24-17-22(9-12-25(24)31(26)18-20-13-15-33-16-14-20)30(5)35-23-10-7-21(8-11-23)28-19(2)32/h7-12,17,20H,6,13-16,18H2,1-5H3,(H,28,32) |
| InChIKey | ZCORMPFBRAGOPE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|