C26H34N4O3S — CID 143022021
N-[4-[ethyl-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide (PubChem CID 143022021) has the molecular formula C26H34N4O3S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[4-[ethyl-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide.
| Compound Name | N-[4-[ethyl-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide |
|---|---|
| PubChem CID | 143022021 |
| Molecular Formula | C26H34N4O3S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | N-[4-[ethyl-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide |
| SMILES | CCN(Sc1ccc(NC=O)cc1)c1ccc2c(c1)nc(C(C)(C)OC)n2CC1CCOCC1 |
| InChI | InChI=1S/C26H34N4O3S/c1-5-30(34-22-9-6-20(7-10-22)27-18-31)21-8-11-24-23(16-21)28-25(26(2,3)32-4)29(24)17-19-12-14-33-15-13-19/h6-11,16,18-19H,5,12-15,17H2,1-4H3,(H,27,31) |
| InChIKey | UYJPLHMYPORBGR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|