C24H32N4O4S — CID 58836953
4-amino-N-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-N-methylbenzenesulfonamide (PubChem CID 58836953) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-amino-N-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-N-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58836953 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-amino-N-[2-(2-methoxypropan-2-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-N-methylbenzenesulfonamide |
| SMILES | COC(C)(C)c1nc2cc(N(C)S(=O)(=O)c3ccc(N)cc3)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C24H32N4O4S/c1-24(2,31-4)23-26-21-15-19(27(3)33(29,30)20-8-5-18(25)6-9-20)7-10-22(21)28(23)16-17-11-13-32-14-12-17/h5-10,15,17H,11-14,16,25H2,1-4H3 |
| InChIKey | DWOOJUCLMYVZRO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|