C21H32N6O3S — CID 163445966
(Z)-3-[[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylsulfamoyl]amino]prop-2-enimidamide (PubChem CID 163445966) has the molecular formula C21H32N6O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is (Z)-3-[[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylsulfamoyl]amino]prop-2-enimidamide.
| Compound Name | (Z)-3-[[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylsulfamoyl]amino]prop-2-enimidamide |
|---|---|
| PubChem CID | 163445966 |
| Molecular Formula | C21H32N6O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (Z)-3-[[[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-methylsulfamoyl]amino]prop-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\NS(=O)(=O)N(C)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCOCC1 |
| InChI | InChI=1S/C21H32N6O3S/c1-21(2,3)20-25-17-13-16(26(4)31(28,29)24-10-7-19(22)23)5-6-18(17)27(20)14-15-8-11-30-12-9-15/h5-7,10,13,15,24H,8-9,11-12,14H2,1-4H3,(H3,22,23)/b10-7- |
| InChIKey | BCNQQQWLNUGMPM-YFHOEESVSA-N |
| XLogP | 2.48 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|