C23H25F3N4O2S — CID 143021897
N-[4-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]acetamide (PubChem CID 143021897) has the molecular formula C23H25F3N4O2S and a molecular weight of 478.54 g/mol. Its IUPAC name is N-[4-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 143021897 |
| Molecular Formula | C23H25F3N4O2S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[4-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SN(C)c2ccc3c(c2)nc(C(F)(F)F)n3CC2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25F3N4O2S/c1-15(31)27-17-3-6-19(7-4-17)33-29(2)18-5-8-21-20(13-18)28-22(23(24,25)26)30(21)14-16-9-11-32-12-10-16/h3-8,13,16H,9-12,14H2,1-2H3,(H,27,31) |
| InChIKey | NIWOPKBYJWOERE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|