C17H20F3N3O6S — CID 150951193
2-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]oxy-2-oxoethanesulfonic acid (PubChem CID 150951193) has the molecular formula C17H20F3N3O6S and a molecular weight of 451.42 g/mol. Its IUPAC name is 2-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]oxy-2-oxoethanesulfonic acid.
| Compound Name | 2-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 150951193 |
| Molecular Formula | C17H20F3N3O6S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-[methyl-[1-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]oxy-2-oxoethanesulfonic acid |
| SMILES | CN(OC(=O)CS(=O)(=O)O)c1ccc2c(c1)nc(C(F)(F)F)n2CC1CCOCC1 |
| InChI | InChI=1S/C17H20F3N3O6S/c1-22(29-15(24)10-30(25,26)27)12-2-3-14-13(8-12)21-16(17(18,19)20)23(14)9-11-4-6-28-7-5-11/h2-3,8,11H,4-7,9-10H2,1H3,(H,25,26,27) |
| InChIKey | LKDCPDIGSWICBS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|