C20H21F3N4OS — CID 143204100
N-[4-[methyl-[1-(2-methylpropyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide (PubChem CID 143204100) has the molecular formula C20H21F3N4OS and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[4-[methyl-[1-(2-methylpropyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide.
| Compound Name | N-[4-[methyl-[1-(2-methylpropyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide |
|---|---|
| PubChem CID | 143204100 |
| Molecular Formula | C20H21F3N4OS |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[4-[methyl-[1-(2-methylpropyl)-2-(trifluoromethyl)benzimidazol-5-yl]amino]sulfanylphenyl]formamide |
| SMILES | CC(C)Cn1c(C(F)(F)F)nc2cc(N(C)Sc3ccc(NC=O)cc3)ccc21 |
| InChI | InChI=1S/C20H21F3N4OS/c1-13(2)11-27-18-9-6-15(10-17(18)25-19(27)20(21,22)23)26(3)29-16-7-4-14(5-8-16)24-12-28/h4-10,12-13H,11H2,1-3H3,(H,24,28) |
| InChIKey | KNCWHNQXSPORLB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|