C28H43N5O2S — CID 143022152
N-[5-[[2-tert-butyl-1-(6-methoxy-4-methylhexyl)benzimidazol-5-yl]-methylamino]sulfanyl-2-pyridinyl]formamide;ethane (PubChem CID 143022152) has the molecular formula C28H43N5O2S and a molecular weight of 513.75 g/mol. Its IUPAC name is N-[5-[[2-tert-butyl-1-(6-methoxy-4-methylhexyl)benzimidazol-5-yl]-methylamino]sulfanyl-2-pyridinyl]formamide;ethane.
| Compound Name | N-[5-[[2-tert-butyl-1-(6-methoxy-4-methylhexyl)benzimidazol-5-yl]-methylamino]sulfanyl-2-pyridinyl]formamide;ethane |
|---|---|
| PubChem CID | 143022152 |
| Molecular Formula | C28H43N5O2S |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | N-[5-[[2-tert-butyl-1-(6-methoxy-4-methylhexyl)benzimidazol-5-yl]-methylamino]sulfanyl-2-pyridinyl]formamide;ethane |
| SMILES | CC.COCCC(C)CCCn1c(C(C)(C)C)nc2cc(N(C)Sc3ccc(NC=O)nc3)ccc21 |
| InChI | InChI=1S/C26H37N5O2S.C2H6/c1-19(13-15-33-6)8-7-14-31-23-11-9-20(16-22(23)29-25(31)26(2,3)4)30(5)34-21-10-12-24(27-17-21)28-18-32;1-2/h9-12,16-19H,7-8,13-15H2,1-6H3,(H,27,28,32);1-2H3 |
| InChIKey | DTXUAZYTDLOTPQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|