C27H36F3N5O2S — CID 143204083
1-tert-butyl-3-[4-[[1-(4-ethoxy-2-methylbutyl)-2-(trifluoromethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]urea (PubChem CID 143204083) has the molecular formula C27H36F3N5O2S and a molecular weight of 551.68 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[[1-(4-ethoxy-2-methylbutyl)-2-(trifluoromethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]urea.
| Compound Name | 1-tert-butyl-3-[4-[[1-(4-ethoxy-2-methylbutyl)-2-(trifluoromethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]urea |
|---|---|
| PubChem CID | 143204083 |
| Molecular Formula | C27H36F3N5O2S |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 1-tert-butyl-3-[4-[[1-(4-ethoxy-2-methylbutyl)-2-(trifluoromethyl)benzimidazol-5-yl]-methylamino]sulfanylphenyl]urea |
| SMILES | CCOCCC(C)Cn1c(C(F)(F)F)nc2cc(N(C)Sc3ccc(NC(=O)NC(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C27H36F3N5O2S/c1-7-37-15-14-18(2)17-35-23-13-10-20(16-22(23)32-24(35)27(28,29)30)34(6)38-21-11-8-19(9-12-21)31-25(36)33-26(3,4)5/h8-13,16,18H,7,14-15,17H2,1-6H3,(H2,31,33,36) |
| InChIKey | ZEXMYRXZPVBZNM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|