C21H24F2N4O2S — CID 143022229
1-[4-[[2-(1,1-difluoroethyl)-1-ethylbenzimidazol-5-yl]-methylamino]sulfanylanilino]-3-hydroxypropan-2-one (PubChem CID 143022229) has the molecular formula C21H24F2N4O2S and a molecular weight of 434.51 g/mol. Its IUPAC name is 1-[4-[[2-(1,1-difluoroethyl)-1-ethylbenzimidazol-5-yl]-methylamino]sulfanylanilino]-3-hydroxypropan-2-one.
| Compound Name | 1-[4-[[2-(1,1-difluoroethyl)-1-ethylbenzimidazol-5-yl]-methylamino]sulfanylanilino]-3-hydroxypropan-2-one |
|---|---|
| PubChem CID | 143022229 |
| Molecular Formula | C21H24F2N4O2S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[4-[[2-(1,1-difluoroethyl)-1-ethylbenzimidazol-5-yl]-methylamino]sulfanylanilino]-3-hydroxypropan-2-one |
| SMILES | CCn1c(C(C)(F)F)nc2cc(N(C)Sc3ccc(NCC(=O)CO)cc3)ccc21 |
| InChI | InChI=1S/C21H24F2N4O2S/c1-4-27-19-10-7-15(11-18(19)25-20(27)21(2,22)23)26(3)30-17-8-5-14(6-9-17)24-12-16(29)13-28/h5-11,24,28H,4,12-13H2,1-3H3 |
| InChIKey | ZWTHLDRLTXEJCX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|