C24H33N5O2S — CID 143022312
N-[4-[(2-tert-butyl-1-ethylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide (PubChem CID 143022312) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is N-[4-[(2-tert-butyl-1-ethylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide.
| Compound Name | N-[4-[(2-tert-butyl-1-ethylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide |
|---|---|
| PubChem CID | 143022312 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N-[4-[(2-tert-butyl-1-ethylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide |
| SMILES | CCn1c(C(C)(C)C)nc2cc(N(C)Sc3ccc(NC(=O)CNCCO)cc3)ccc21 |
| InChI | InChI=1S/C24H33N5O2S/c1-6-29-21-12-9-18(15-20(21)27-23(29)24(2,3)4)28(5)32-19-10-7-17(8-11-19)26-22(31)16-25-13-14-30/h7-12,15,25,30H,6,13-14,16H2,1-5H3,(H,26,31) |
| InChIKey | FJUASHXVQLJVHZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|