C33H49N5OS — CID 143022154
N-[4-[(2-tert-butyl-1-methylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-pyrrolidin-1-ylacetamide;methylcycloheptane (PubChem CID 143022154) has the molecular formula C33H49N5OS and a molecular weight of 563.86 g/mol. Its IUPAC name is N-[4-[(2-tert-butyl-1-methylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-pyrrolidin-1-ylacetamide;methylcycloheptane.
| Compound Name | N-[4-[(2-tert-butyl-1-methylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-pyrrolidin-1-ylacetamide;methylcycloheptane |
|---|---|
| PubChem CID | 143022154 |
| Molecular Formula | C33H49N5OS |
| Molecular Weight | 563.86 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | N-[4-[(2-tert-butyl-1-methylbenzimidazol-5-yl)-methylamino]sulfanylphenyl]-2-pyrrolidin-1-ylacetamide;methylcycloheptane |
| SMILES | CC1CCCCCC1.CN(Sc1ccc(NC(=O)CN2CCCC2)cc1)c1ccc2c(c1)nc(C(C)(C)C)n2C |
| InChI | InChI=1S/C25H33N5OS.C8H16/c1-25(2,3)24-27-21-16-19(10-13-22(21)28(24)4)29(5)32-20-11-8-18(9-12-20)26-23(31)17-30-14-6-7-15-30;1-8-6-4-2-3-5-7-8/h8-13,16H,6-7,14-15,17H2,1-5H3,(H,26,31);8H,2-7H2,1H3 |
| InChIKey | JOWNMYSNBOWNNR-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.86 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|