C23H29N3S — CID 143022011
2-tert-butyl-1-(cyclobutylmethyl)-N-methyl-N-phenylsulfanylbenzimidazol-5-amine (PubChem CID 143022011) has the molecular formula C23H29N3S and a molecular weight of 379.57 g/mol. Its IUPAC name is 2-tert-butyl-1-(cyclobutylmethyl)-N-methyl-N-phenylsulfanylbenzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-(cyclobutylmethyl)-N-methyl-N-phenylsulfanylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 143022011 |
| Molecular Formula | C23H29N3S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-tert-butyl-1-(cyclobutylmethyl)-N-methyl-N-phenylsulfanylbenzimidazol-5-amine |
| SMILES | CN(Sc1ccccc1)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCC1 |
| InChI | InChI=1S/C23H29N3S/c1-23(2,3)22-24-20-15-18(25(4)27-19-11-6-5-7-12-19)13-14-21(20)26(22)16-17-9-8-10-17/h5-7,11-15,17H,8-10,16H2,1-4H3 |
| InChIKey | RJYSPJNHNANJFV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|