C23H34N5OS+ — CID 143204105
2-tert-butyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanyl-1-(oxepan-4-ylmethyl)benzimidazol-5-amine (PubChem CID 143204105) has the molecular formula C23H34N5OS+ and a molecular weight of 428.63 g/mol. Its IUPAC name is 2-tert-butyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanyl-1-(oxepan-4-ylmethyl)benzimidazol-5-amine.
| Compound Name | 2-tert-butyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanyl-1-(oxepan-4-ylmethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 143204105 |
| Molecular Formula | C23H34N5OS+ |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-tert-butyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanyl-1-(oxepan-4-ylmethyl)benzimidazol-5-amine |
| SMILES | CN(Sn1cc[n+](C)c1)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCCOCC1 |
| InChI | InChI=1S/C23H34N5OS/c1-23(2,3)22-24-20-15-19(26(5)30-27-12-11-25(4)17-27)8-9-21(20)28(22)16-18-7-6-13-29-14-10-18/h8-9,11-12,15,17-18H,6-7,10,13-14,16H2,1-5H3/q+1 |
| InChIKey | COWMVDPCPUQQFJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|