C18H26N5S+ — CID 143204170
2-tert-butyl-1-ethyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanylbenzimidazol-5-amine (PubChem CID 143204170) has the molecular formula C18H26N5S+ and a molecular weight of 344.51 g/mol. Its IUPAC name is 2-tert-butyl-1-ethyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanylbenzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-ethyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 143204170 |
| Molecular Formula | C18H26N5S+ |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-tert-butyl-1-ethyl-N-methyl-N-(3-methylimidazol-3-ium-1-yl)sulfanylbenzimidazol-5-amine |
| SMILES | CCn1c(C(C)(C)C)nc2cc(N(C)Sn3cc[n+](C)c3)ccc21 |
| InChI | InChI=1S/C18H26N5S/c1-7-23-16-9-8-14(12-15(16)19-17(23)18(2,3)4)21(6)24-22-11-10-20(5)13-22/h8-13H,7H2,1-6H3/q+1 |
| InChIKey | FSCRTZICDSEZQN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|