C23H39N5OS — CID 143204197
2-tert-butyl-1-(2-ethyl-4-methoxybutyl)-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine (PubChem CID 143204197) has the molecular formula C23H39N5OS and a molecular weight of 433.67 g/mol. Its IUPAC name is 2-tert-butyl-1-(2-ethyl-4-methoxybutyl)-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-(2-ethyl-4-methoxybutyl)-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 143204197 |
| Molecular Formula | C23H39N5OS |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 2-tert-butyl-1-(2-ethyl-4-methoxybutyl)-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine |
| SMILES | CCC(CCOC)Cn1c(C(C)(C)C)nc2cc(N(C)SN3CCNCC3)ccc21 |
| InChI | InChI=1S/C23H39N5OS/c1-7-18(10-15-29-6)17-28-21-9-8-19(16-20(21)25-22(28)23(2,3)4)26(5)30-27-13-11-24-12-14-27/h8-9,16,18,24H,7,10-15,17H2,1-6H3 |
| InChIKey | NOXVCKSFYBZHKV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|