C19H30N4O2S — CID 143203982
methyl 2-[[(2-tert-butyl-1-propylbenzimidazol-5-yl)-methylamino]sulfanyl-methylamino]acetate (PubChem CID 143203982) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is methyl 2-[[(2-tert-butyl-1-propylbenzimidazol-5-yl)-methylamino]sulfanyl-methylamino]acetate.
| Compound Name | methyl 2-[[(2-tert-butyl-1-propylbenzimidazol-5-yl)-methylamino]sulfanyl-methylamino]acetate |
|---|---|
| PubChem CID | 143203982 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | methyl 2-[[(2-tert-butyl-1-propylbenzimidazol-5-yl)-methylamino]sulfanyl-methylamino]acetate |
| SMILES | CCCn1c(C(C)(C)C)nc2cc(N(C)SN(C)CC(=O)OC)ccc21 |
| InChI | InChI=1S/C19H30N4O2S/c1-8-11-23-16-10-9-14(12-15(16)20-18(23)19(2,3)4)22(6)26-21(5)13-17(24)25-7/h9-10,12H,8,11,13H2,1-7H3 |
| InChIKey | IQNNLLJYAAMEHV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|