C20H28N2O3S — CID 91338809
methyl 2-[2-tert-butyl-1-[(1-hydroxycyclopentyl)methyl]benzimidazol-5-yl]sulfanylacetate (PubChem CID 91338809) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is methyl 2-[2-tert-butyl-1-[(1-hydroxycyclopentyl)methyl]benzimidazol-5-yl]sulfanylacetate.
| Compound Name | methyl 2-[2-tert-butyl-1-[(1-hydroxycyclopentyl)methyl]benzimidazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 91338809 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | methyl 2-[2-tert-butyl-1-[(1-hydroxycyclopentyl)methyl]benzimidazol-5-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1ccc2c(c1)nc(C(C)(C)C)n2CC1(O)CCCC1 |
| InChI | InChI=1S/C20H28N2O3S/c1-19(2,3)18-21-15-11-14(26-12-17(23)25-4)7-8-16(15)22(18)13-20(24)9-5-6-10-20/h7-8,11,24H,5-6,9-10,12-13H2,1-4H3 |
| InChIKey | ZJJMPKXDLSBISY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |