C18H26N2OS — CID 143224299
1-[(2-tert-butyl-5-methylsulfanylbenzimidazol-1-yl)methyl]cyclopentan-1-ol (PubChem CID 143224299) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-[(2-tert-butyl-5-methylsulfanylbenzimidazol-1-yl)methyl]cyclopentan-1-ol.
| Compound Name | 1-[(2-tert-butyl-5-methylsulfanylbenzimidazol-1-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 143224299 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-[(2-tert-butyl-5-methylsulfanylbenzimidazol-1-yl)methyl]cyclopentan-1-ol |
| SMILES | CSc1ccc2c(c1)nc(C(C)(C)C)n2CC1(O)CCCC1 |
| InChI | InChI=1S/C18H26N2OS/c1-17(2,3)16-19-14-11-13(22-4)7-8-15(14)20(16)12-18(21)9-5-6-10-18/h7-8,11,21H,5-6,9-10,12H2,1-4H3 |
| InChIKey | RQGWCDOLYOEBNO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |