C21H29F2N3OS — CID 143562116
1-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfanylazetidin-3-ol (PubChem CID 143562116) has the molecular formula C21H29F2N3OS and a molecular weight of 409.55 g/mol. Its IUPAC name is 1-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfanylazetidin-3-ol.
| Compound Name | 1-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfanylazetidin-3-ol |
|---|---|
| PubChem CID | 143562116 |
| Molecular Formula | C21H29F2N3OS |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfanylazetidin-3-ol |
| SMILES | CC(C)(C)c1nc2cc(SN3CC(O)C3)ccc2n1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H29F2N3OS/c1-20(2,3)19-24-17-10-16(28-25-12-15(27)13-25)4-5-18(17)26(19)11-14-6-8-21(22,23)9-7-14/h4-5,10,14-15,27H,6-9,11-13H2,1-3H3 |
| InChIKey | UVKLFOREQCIOAE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|