C20H31F2N3O6S2 — CID 24785648
N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]ethanesulfonamide;sulfuric acid (PubChem CID 24785648) has the molecular formula C20H31F2N3O6S2 and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]ethanesulfonamide;sulfuric acid.
| Compound Name | N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]ethanesulfonamide;sulfuric acid |
|---|---|
| PubChem CID | 24785648 |
| Molecular Formula | C20H31F2N3O6S2 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]ethanesulfonamide;sulfuric acid |
| SMILES | CCS(=O)(=O)Nc1ccc2c(c1)nc(C(C)(C)C)n2CC1CCC(F)(F)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C20H29F2N3O2S.H2O4S/c1-5-28(26,27)24-15-6-7-17-16(12-15)23-18(19(2,3)4)25(17)13-14-8-10-20(21,22)11-9-14;1-5(2,3)4/h6-7,12,14,24H,5,8-11,13H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | RGRDEHOLGWALOQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|