C25H35F2N3O3 — CID 163923547
[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-[4-(dihydroxymethyl)piperidin-1-yl]methanone (PubChem CID 163923547) has the molecular formula C25H35F2N3O3 and a molecular weight of 463.57 g/mol. Its IUPAC name is [2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-[4-(dihydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | [2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-[4-(dihydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163923547 |
| Molecular Formula | C25H35F2N3O3 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | [2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]-[4-(dihydroxymethyl)piperidin-1-yl]methanone |
| SMILES | CC(C)(C)c1nc2cc(C(=O)N3CCC(C(O)O)CC3)ccc2n1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C25H35F2N3O3/c1-24(2,3)23-28-19-14-18(21(31)29-12-8-17(9-13-29)22(32)33)4-5-20(19)30(23)15-16-6-10-25(26,27)11-7-16/h4-5,14,16-17,22,32-33H,6-13,15H2,1-3H3 |
| InChIKey | RCMNMIYOYXPUHE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|