C22H28F2N4O4S — CID 146951315
3-amino-2-[[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfonyliminomethyl]prop-2-enoic acid (PubChem CID 146951315) has the molecular formula C22H28F2N4O4S and a molecular weight of 482.55 g/mol. Its IUPAC name is 3-amino-2-[[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfonyliminomethyl]prop-2-enoic acid.
| Compound Name | 3-amino-2-[[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfonyliminomethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146951315 |
| Molecular Formula | C22H28F2N4O4S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 3-amino-2-[[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]sulfonyliminomethyl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1nc2cc(S(=O)(=O)N=CC(=CN)C(=O)O)ccc2n1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C22H28F2N4O4S/c1-21(2,3)20-27-17-10-16(33(31,32)26-12-15(11-25)19(29)30)4-5-18(17)28(20)13-14-6-8-22(23,24)9-7-14/h4-5,10-12,14H,6-9,13,25H2,1-3H3,(H,29,30) |
| InChIKey | CLNGHXYSHBKWDS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|