C24H36F2N4OS — CID 143204235
2-tert-butyl-1-[(4,4-difluorocycloheptyl)methyl]-N-methyl-N-morpholin-4-ylsulfanylbenzimidazol-5-amine (PubChem CID 143204235) has the molecular formula C24H36F2N4OS and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-tert-butyl-1-[(4,4-difluorocycloheptyl)methyl]-N-methyl-N-morpholin-4-ylsulfanylbenzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-[(4,4-difluorocycloheptyl)methyl]-N-methyl-N-morpholin-4-ylsulfanylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 143204235 |
| Molecular Formula | C24H36F2N4OS |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-tert-butyl-1-[(4,4-difluorocycloheptyl)methyl]-N-methyl-N-morpholin-4-ylsulfanylbenzimidazol-5-amine |
| SMILES | CN(SN1CCOCC1)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C24H36F2N4OS/c1-23(2,3)22-27-20-16-19(28(4)32-29-12-14-31-15-13-29)7-8-21(20)30(22)17-18-6-5-10-24(25,26)11-9-18/h7-8,16,18H,5-6,9-15,17H2,1-4H3 |
| InChIKey | DARHLFQQXSIUHU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|