C25H43N5OS — CID 143204262
2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine;4-methyloxepane (PubChem CID 143204262) has the molecular formula C25H43N5OS and a molecular weight of 461.72 g/mol. Its IUPAC name is 2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine;4-methyloxepane.
| Compound Name | 2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine;4-methyloxepane |
|---|---|
| PubChem CID | 143204262 |
| Molecular Formula | C25H43N5OS |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine;4-methyloxepane |
| SMILES | CC1CCCOCC1.CCn1c(C(C)(C)C)nc2cc(N(C)SN3CCNCC3)ccc21 |
| InChI | InChI=1S/C18H29N5S.C7H14O/c1-6-23-16-8-7-14(13-15(16)20-17(23)18(2,3)4)21(5)24-22-11-9-19-10-12-22;1-7-3-2-5-8-6-4-7/h7-8,13,19H,6,9-12H2,1-5H3;7H,2-6H2,1H3 |
| InChIKey | HIIMMFAMAHPGNW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|