C29H48N6O2S — CID 143204176
[4-[[2-tert-butyl-1-(5-ethoxy-2-methylpentyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 143204176) has the molecular formula C29H48N6O2S and a molecular weight of 544.81 g/mol. Its IUPAC name is [4-[[2-tert-butyl-1-(5-ethoxy-2-methylpentyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[2-tert-butyl-1-(5-ethoxy-2-methylpentyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 143204176 |
| Molecular Formula | C29H48N6O2S |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | [4-[[2-tert-butyl-1-(5-ethoxy-2-methylpentyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCOCCCC(C)Cn1c(C(C)(C)C)nc2cc(N(C)SN3CCN(C(=O)N4CCCC4)CC3)ccc21 |
| InChI | InChI=1S/C29H48N6O2S/c1-7-37-20-10-11-23(2)22-35-26-13-12-24(21-25(26)30-27(35)29(3,4)5)31(6)38-34-18-16-33(17-19-34)28(36)32-14-8-9-15-32/h12-13,21,23H,7-11,14-20,22H2,1-6H3 |
| InChIKey | UBOKLVSHUYKIFB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 57.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|