C18H29N5S — CID 143204263
2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine (PubChem CID 143204263) has the molecular formula C18H29N5S and a molecular weight of 347.53 g/mol. Its IUPAC name is 2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 143204263 |
| Molecular Formula | C18H29N5S |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-tert-butyl-1-ethyl-N-methyl-N-piperazin-1-ylsulfanylbenzimidazol-5-amine |
| SMILES | CCn1c(C(C)(C)C)nc2cc(N(C)SN3CCNCC3)ccc21 |
| InChI | InChI=1S/C18H29N5S/c1-6-23-16-8-7-14(13-15(16)20-17(23)18(2,3)4)21(5)24-22-11-9-19-10-12-22/h7-8,13,19H,6,9-12H2,1-5H3 |
| InChIKey | DFJAXMWGHPTPRR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|