C26H43N5O2S — CID 143204196
1-[4-[[2-tert-butyl-1-(4-ethoxy-2-methylbutyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]propan-1-one (PubChem CID 143204196) has the molecular formula C26H43N5O2S and a molecular weight of 489.73 g/mol. Its IUPAC name is 1-[4-[[2-tert-butyl-1-(4-ethoxy-2-methylbutyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[[2-tert-butyl-1-(4-ethoxy-2-methylbutyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 143204196 |
| Molecular Formula | C26H43N5O2S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 1-[4-[[2-tert-butyl-1-(4-ethoxy-2-methylbutyl)benzimidazol-5-yl]-methylamino]sulfanylpiperazin-1-yl]propan-1-one |
| SMILES | CCOCCC(C)Cn1c(C(C)(C)C)nc2cc(N(C)SN3CCN(C(=O)CC)CC3)ccc21 |
| InChI | InChI=1S/C26H43N5O2S/c1-8-24(32)29-13-15-30(16-14-29)34-28(7)21-10-11-23-22(18-21)27-25(26(4,5)6)31(23)19-20(3)12-17-33-9-2/h10-11,18,20H,8-9,12-17,19H2,1-7H3 |
| InChIKey | RARUQKOOSMPSOF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|