C27H40N4O2S — CID 143022293
2-tert-butyl-1-ethyl-N-methyl-N-(4-nitrophenyl)sulfanylbenzimidazol-5-amine;heptane (PubChem CID 143022293) has the molecular formula C27H40N4O2S and a molecular weight of 484.71 g/mol. Its IUPAC name is 2-tert-butyl-1-ethyl-N-methyl-N-(4-nitrophenyl)sulfanylbenzimidazol-5-amine;heptane.
| Compound Name | 2-tert-butyl-1-ethyl-N-methyl-N-(4-nitrophenyl)sulfanylbenzimidazol-5-amine;heptane |
|---|---|
| PubChem CID | 143022293 |
| Molecular Formula | C27H40N4O2S |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 2-tert-butyl-1-ethyl-N-methyl-N-(4-nitrophenyl)sulfanylbenzimidazol-5-amine;heptane |
| SMILES | CCCCCCC.CCn1c(C(C)(C)C)nc2cc(N(C)Sc3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C20H24N4O2S.C7H16/c1-6-23-18-12-9-15(13-17(18)21-19(23)20(2,3)4)22(5)27-16-10-7-14(8-11-16)24(25)26;1-3-5-7-6-4-2/h7-13H,6H2,1-5H3;3-7H2,1-2H3 |
| InChIKey | OUFNVZJRZOZHAY-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|