C20H27F3N2S — CID 42642517
2-tert-butyl-5-(cyclopropylmethylsulfanyl)-1-(5,5,5-trifluoropentyl)benzimidazole (PubChem CID 42642517) has the molecular formula C20H27F3N2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-tert-butyl-5-(cyclopropylmethylsulfanyl)-1-(5,5,5-trifluoropentyl)benzimidazole.
| Compound Name | 2-tert-butyl-5-(cyclopropylmethylsulfanyl)-1-(5,5,5-trifluoropentyl)benzimidazole |
|---|---|
| PubChem CID | 42642517 |
| Molecular Formula | C20H27F3N2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-tert-butyl-5-(cyclopropylmethylsulfanyl)-1-(5,5,5-trifluoropentyl)benzimidazole |
| SMILES | CC(C)(C)c1nc2cc(SCC3CC3)ccc2n1CCCCC(F)(F)F |
| InChI | InChI=1S/C20H27F3N2S/c1-19(2,3)18-24-16-12-15(26-13-14-6-7-14)8-9-17(16)25(18)11-5-4-10-20(21,22)23/h8-9,12,14H,4-7,10-11,13H2,1-3H3 |
| InChIKey | FATWTVZLRCMTMJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|