C23H28BrClN4OS — CID 143021999
N-[(5-bromo-6-chloro-3-pyridinyl)sulfanyl]-2-tert-butyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazol-5-amine (PubChem CID 143021999) has the molecular formula C23H28BrClN4OS and a molecular weight of 523.93 g/mol. Its IUPAC name is N-[(5-bromo-6-chloro-3-pyridinyl)sulfanyl]-2-tert-butyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazol-5-amine.
| Compound Name | N-[(5-bromo-6-chloro-3-pyridinyl)sulfanyl]-2-tert-butyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 143021999 |
| Molecular Formula | C23H28BrClN4OS |
| Molecular Weight | 523.93 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | N-[(5-bromo-6-chloro-3-pyridinyl)sulfanyl]-2-tert-butyl-N-methyl-1-(oxan-4-ylmethyl)benzimidazol-5-amine |
| SMILES | CN(Sc1cnc(Cl)c(Br)c1)c1ccc2c(c1)nc(C(C)(C)C)n2CC1CCOCC1 |
| InChI | InChI=1S/C23H28BrClN4OS/c1-23(2,3)22-27-19-11-16(28(4)31-17-12-18(24)21(25)26-13-17)5-6-20(19)29(22)14-15-7-9-30-10-8-15/h5-6,11-13,15H,7-10,14H2,1-4H3 |
| InChIKey | HTGSBQDGCGUCOY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.93 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|