C23H29N3OS — CID 143561930
1-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfanylpyrrole-3-carbaldehyde (PubChem CID 143561930) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfanylpyrrole-3-carbaldehyde.
| Compound Name | 1-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfanylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 143561930 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[2-tert-butyl-1-(cyclohexylmethyl)benzimidazol-5-yl]sulfanylpyrrole-3-carbaldehyde |
| SMILES | CC(C)(C)c1nc2cc(Sn3ccc(C=O)c3)ccc2n1CC1CCCCC1 |
| InChI | InChI=1S/C23H29N3OS/c1-23(2,3)22-24-20-13-19(28-25-12-11-18(14-25)16-27)9-10-21(20)26(22)15-17-7-5-4-6-8-17/h9-14,16-17H,4-8,15H2,1-3H3 |
| InChIKey | YFIQCIIWBXJNPV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|