C17H20N4 — CID 143022371
7-(quinoxalin-2-ylmethyl)-4,7-diazatricyclo[6.2.0.01,4]decane (PubChem CID 143022371) has the molecular formula C17H20N4 and a molecular weight of 280.37 g/mol. Its IUPAC name is 7-(quinoxalin-2-ylmethyl)-4,7-diazatricyclo[6.2.0.01,4]decane.
| Compound Name | 7-(quinoxalin-2-ylmethyl)-4,7-diazatricyclo[6.2.0.01,4]decane |
|---|---|
| PubChem CID | 143022371 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 7-(quinoxalin-2-ylmethyl)-4,7-diazatricyclo[6.2.0.01,4]decane |
| SMILES | c1ccc2nc(CN3CCN4CCC45CCC35)cnc2c1 |
| InChI | InChI=1S/C17H20N4/c1-2-4-15-14(3-1)18-11-13(19-15)12-20-9-10-21-8-7-17(21)6-5-16(17)20/h1-4,11,16H,5-10,12H2 |
| InChIKey | BOVCVNXVPNIGDQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |