C16H21N3O2S — CID 167746759
2-[[3-(methylsulfonylmethyl)piperidin-1-yl]methyl]quinoxaline (PubChem CID 167746759) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[[3-(methylsulfonylmethyl)piperidin-1-yl]methyl]quinoxaline.
| Compound Name | 2-[[3-(methylsulfonylmethyl)piperidin-1-yl]methyl]quinoxaline |
|---|---|
| PubChem CID | 167746759 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[[3-(methylsulfonylmethyl)piperidin-1-yl]methyl]quinoxaline |
| SMILES | CS(=O)(=O)CC1CCCN(Cc2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C16H21N3O2S/c1-22(20,21)12-13-5-4-8-19(10-13)11-14-9-17-15-6-2-3-7-16(15)18-14/h2-3,6-7,9,13H,4-5,8,10-12H2,1H3 |
| InChIKey | KGKLXNRHFSYMEQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |