C16H21N3O2S2 — CID 99936698
5-[[(3R)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-2-thiophen-2-ylpyrimidine (PubChem CID 99936698) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 5-[[(3R)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-2-thiophen-2-ylpyrimidine.
| Compound Name | 5-[[(3R)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-2-thiophen-2-ylpyrimidine |
|---|---|
| PubChem CID | 99936698 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-[[(3R)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-2-thiophen-2-ylpyrimidine |
| SMILES | CS(=O)(=O)C[C@@H]1CCCN(Cc2cnc(-c3cccs3)nc2)C1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-23(20,21)12-13-4-2-6-19(10-13)11-14-8-17-16(18-9-14)15-5-3-7-22-15/h3,5,7-9,13H,2,4,6,10-12H2,1H3/t13-/m1/s1 |
| InChIKey | WKAHZOOHUZDTQW-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |