C13H17N5O2S2 — CID 77096663
4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazine-1-sulfonamide (PubChem CID 77096663) has the molecular formula C13H17N5O2S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 77096663 |
| Molecular Formula | C13H17N5O2S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(Cc2cnc(-c3cccs3)nc2)CC1 |
| InChI | InChI=1S/C13H17N5O2S2/c14-22(19,20)18-5-3-17(4-6-18)10-11-8-15-13(16-9-11)12-2-1-7-21-12/h1-2,7-9H,3-6,10H2,(H2,14,19,20) |
| InChIKey | AVSTXBFZJXGZTH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |