C18H19N5OS — CID 77087896
1H-pyrrol-2-yl-[4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazin-1-yl]methanone (PubChem CID 77087896) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 1H-pyrrol-2-yl-[4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | 1H-pyrrol-2-yl-[4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 77087896 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1H-pyrrol-2-yl-[4-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc[nH]1)N1CCN(Cc2cnc(-c3cccs3)nc2)CC1 |
| InChI | InChI=1S/C18H19N5OS/c24-18(15-3-1-5-19-15)23-8-6-22(7-9-23)13-14-11-20-17(21-12-14)16-4-2-10-25-16/h1-5,10-12,19H,6-9,13H2 |
| InChIKey | OYPLYOHCZBNYKH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |