C18H25N5OS — CID 77084675
[4-[(2-butan-2-ylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 77084675) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is [4-[(2-butan-2-ylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [4-[(2-butan-2-ylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 77084675 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [4-[(2-butan-2-ylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CCC(C)Sc1ncc(CN2CCN(C(=O)c3ccc[nH]3)CC2)cn1 |
| InChI | InChI=1S/C18H25N5OS/c1-3-14(2)25-18-20-11-15(12-21-18)13-22-7-9-23(10-8-22)17(24)16-5-4-6-19-16/h4-6,11-12,14,19H,3,7-10,13H2,1-2H3 |
| InChIKey | DTSSIDUGEFBHJR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |