C12H19N3O4S — CID 99938873
4-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 99938873) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 99938873 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)C[C@H]1CCCN(Cc2cn[nH]c2C(=O)O)C1 |
| InChI | InChI=1S/C12H19N3O4S/c1-20(18,19)8-9-3-2-4-15(6-9)7-10-5-13-14-11(10)12(16)17/h5,9H,2-4,6-8H2,1H3,(H,13,14)(H,16,17)/t9-/m0/s1 |
| InChIKey | AXFQUDVDTTVHAG-VIFPVBQESA-N |
| XLogP | 0.36 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |