C16H23NO5S — CID 99930028
2-[2-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 99930028) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[2-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 99930028 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[2-[[(3S)-3-(methylsulfonylmethyl)piperidin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | CS(=O)(=O)C[C@H]1CCCN(Cc2ccccc2OCC(=O)O)C1 |
| InChI | InChI=1S/C16H23NO5S/c1-23(20,21)12-13-5-4-8-17(9-13)10-14-6-2-3-7-15(14)22-11-16(18)19/h2-3,6-7,13H,4-5,8-12H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | CORZQPOJOCUUKV-ZDUSSCGKSA-N |
| XLogP | 1.41 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |