C19H20FNO3 — CID 56915846
2-[2-[[3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 56915846) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[2-[[3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 56915846 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[2-[[3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1CN1CCC(c2ccccc2F)C1 |
| InChI | InChI=1S/C19H20FNO3/c20-17-7-3-2-6-16(17)14-9-10-21(11-14)12-15-5-1-4-8-18(15)24-13-19(22)23/h1-8,14H,9-13H2,(H,22,23) |
| InChIKey | QAZOCWYAZDRUJH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |