C24H30N4O2 — CID 143022457
N-(2-ethyloxiran-2-yl)-N-methyl-1-(oxan-4-ylmethyl)-2-(pyridin-2-ylmethyl)benzimidazol-5-amine (PubChem CID 143022457) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-(2-ethyloxiran-2-yl)-N-methyl-1-(oxan-4-ylmethyl)-2-(pyridin-2-ylmethyl)benzimidazol-5-amine.
| Compound Name | N-(2-ethyloxiran-2-yl)-N-methyl-1-(oxan-4-ylmethyl)-2-(pyridin-2-ylmethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 143022457 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-(2-ethyloxiran-2-yl)-N-methyl-1-(oxan-4-ylmethyl)-2-(pyridin-2-ylmethyl)benzimidazol-5-amine |
| SMILES | CCC1(N(C)c2ccc3c(c2)nc(Cc2ccccn2)n3CC2CCOCC2)CO1 |
| InChI | InChI=1S/C24H30N4O2/c1-3-24(17-30-24)27(2)20-7-8-22-21(15-20)26-23(14-19-6-4-5-11-25-19)28(22)16-18-9-12-29-13-10-18/h4-8,11,15,18H,3,9-10,12-14,16-17H2,1-2H3 |
| InChIKey | LFMFYPKPJAVLKW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|