C22H23F3N4O3 — CID 143022780
2-ethyl-6-[[5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]hexanoic acid (PubChem CID 143022780) has the molecular formula C22H23F3N4O3 and a molecular weight of 448.45 g/mol. Its IUPAC name is 2-ethyl-6-[[5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 2-ethyl-6-[[5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 143022780 |
| Molecular Formula | C22H23F3N4O3 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-ethyl-6-[[5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CCC(CCCCNC(=O)c1cc2nc(-c3ccccc3)cc(C(F)(F)F)n2n1)C(=O)O |
| InChI | InChI=1S/C22H23F3N4O3/c1-2-14(21(31)32)8-6-7-11-26-20(30)17-13-19-27-16(15-9-4-3-5-10-15)12-18(22(23,24)25)29(19)28-17/h3-5,9-10,12-14H,2,6-8,11H2,1H3,(H,26,30)(H,31,32) |
| InChIKey | WMLCGJIECVJQDC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|